MathMaster logo

MathMaster

  1. Home
  2. general
  3. there are 500 000 bacteria at the end of a pin point 1000 bacteria can make a person sick then bacteria at the tip of a pi
Question

there are 500,000 bacteria at the end of a pin point. 1000 bacteria can make a person sick. then bacteria at the tip of a pin point can make 500 people sick. Also, many people do not know that bacteria can (reproduce). Let's say there are 5 bacteria and we leave it for 15 minutes. bacteria will multiply to 10. if left for up to 30 minutes, 20 bacteria will form. if left up to 45 minutes. bacteria will multiply up to 40. every 15 minutes the bacteria will double 2. if you start with five bacteria that reproduce every 15 minutes, how manu bacteria would you have after 12 hours ?

258

likes
1290 views

Answer to a math question there are 500,000 bacteria at the end of a pin point. 1000 bacteria can make a person sick. then bacteria at the tip of a pin point can make 500 people sick. Also, many people do not know that bacteria can (reproduce). Let's say there are 5 bacteria and we leave it for 15 minutes. bacteria will multiply to 10. if left for up to 30 minutes, 20 bacteria will form. if left up to 45 minutes. bacteria will multiply up to 40. every 15 minutes the bacteria will double 2. if you start with five bacteria that reproduce every 15 minutes, how manu bacteria would you have after 12 hours ?

Expert avatar
Jayne
4.4
106 Answers
If the bacteria double every 15 minutes, we can calculate the number of bacteria after 12 hours (720 minutes) by dividing the total time by the doubling time. Doubling time = 15 minutes Total time = 12 hours = 720 minutes Number of doubling periods = Total time / Doubling time Number of doubling periods = 720 minutes / 15 minutes = 48 doubling periods Now, if you start with 5 bacteria and they double 48 times, you can calculate the total number of bacteria using the formula: Final number of bacteria = Initial number of bacteria * (2^Number of doubling periods) Final number of bacteria = 5 * (2^48) Calculating this, we get: Final number of bacteria = 1,407,374,883,553,280 So, after 12 hours, starting with 5 bacteria that double every 15 minutes, you would have 1,407,374,883,553,280 bacteria.

Frequently asked questions (FAQs)
What are the roots of the quadratic equation 2x^2 + 3x - 5 = 0?
+
Math question: What is the median of the following numbers: 5, 8, 12, 7, 8, 10, 12, 5?
+
What is the value of sinh(cosh(arcsinh(arccosh(2))))?
+
New questions in Mathematics
8x-(5-x)
-11+29-18
The actual length of an object is 1.3 m . If the blueprint uses a scale of 1 : 12 , what is the length of the line on the drawing?
Divide 22 by 5 solve it by array and an area model
You are planning to buy a car worth $20,000. Which of the two deals described below would you choose, both with a 48-month term? (NB: estimate the monthly payment of each offer). i) the dealer offers to take 10% off the price, then lend you the balance at an annual percentage rate (APR) of 9%, monthly compounding. ii) the dealer offers to lend you $20,000 (i.e., no discount) at an APR of 3%, monthly compounding.
A National Solidarity Bond offers A 5 year bond offering a gross return of 15% Calculate the AER for this investment. (Give your answer to two decimal places, no need for the percent or € sign in your answer)
41/39 - 1/38
2x+4x=
The market for economics textbooks is represented by the following supply and demand equations: P = 5 + 2Qs P = 20 - Qd Where P is the price in £s and Qs and Qd are the quantities supplied and demanded in thousands. What is the equilibrium price?
ind the z-score for which 72% of the distribution's area lies between -z and z. -1.7417, 1.7417 -1.1538, 1.1538 -1.0803, 1.0803 -2.826, 2.826
(X+2)(x+3)=4x+18
Let X be a discrete random variable such that E(X)=3 and V(X)=5. Let 𝑌 = 2𝑋^2 − 3𝑋. Determine E(Y).
48 kg of 30% sulfuric acid in a mixture of 10% and 40% sulfuric acid arose. How many kilograms were each of the original solutions?
Translate to an equation and solve. Let x be the unknown number: What number is 52% of 81.
A buyer purchased a North Carolina home for $475,250. The seller allowed the buyer to assume his first small mortgage with a loan balance of $110,000. How much is the excise tax paid in the transaction? $951 $729.50 $950.50 $221 none of the above
Read the “Local Communities as Stakeholders: Does Amazon Really Need Tax Breaks?” example on p. 83 in Ch. 3 of Management: A Practical Introduction. In your response, discuss whether you feel that tax breaks for big companies benefit local communities. Describe ways to attract business to a region without having a negative impact on the larger community.
If the mean of the following numbers is 17, find the c value. Produce an algebraic solution. Guess and check is unacceptable. 12, 18, 21, c, 13
Determine the general solution of the equation y′+y=e−x .
Exercise The temperature T in degrees Celsius of a chemical reaction is given as a function of time t, expressed in minutes, by the function defined on ¿ by: T (t )=(20 t +10)e−0.5t. 1) What is the initial temperature? 2) Show that T' (t )=(−10 t +15)e−0 .5t. 3) Study the sign of T' (t ), then draw up the table of variations of T . We do not ask for the limit of T in +∞. 4) What is the maximum temperature reached by the reaction chemical. We will give an approximate value to within 10−2. 5) After how long does the temperature T go back down to its initial value? We will give an approximate value of this time in minutes and seconds. DM 2: study of a function Exercise The temperature T in degrees Celsius of a chemical reaction is given as a function of time t, expressed in minutes, by the function defined on ¿ by: T (t )=(20 t +10)e−0.5t. 1) What is the initial temperature? 2) Show that T' (t )=(−10 t +15)e−0.5 t. 3) Study the sign of T' (t ), then draw up the table of variations of T . We do not ask for the limit of T in +∞. 4) What is the maximum temperature reached by the reaction chemical. We will give an approximate value to within 10−2. 5) After how long does the temperature T go back down to its initial value? We will give an approximate value of this time in minutes and seconds.
The car with an irresponsible driver starts to brake when it goes through a red light. When passing the traffic light, he does so at a speed of 115 kph in the right lane. Further ahead, 70 meters from the traffic light, a child is crossing the street and falls. If the effect of the car's brakes is equivalent to a deceleration of magnitude 5.7m/s². Is the child hit by the car or not? How far from the traffic light does the car stop?

You might be interested in