Question

Let q represent the amount of output produced by a particular firm. Let TC denote total costs of production for this firm, FC denote fixed costs, VC denote variable costs, MC denote marginal costs, ATC denote average total costs, and AVC denote average variable costs. Using this notation, the following is true about the firm’s cost structure: FC=$100 at q=0. MC=$60 at q=1. VC=$110 at q=2. ATC=$90 at q=3. AVC=$60 at q=4. TC=$420 at q=5. In dollars, what is TC at q=0? (Enter a number.) (Hint: Make a table with 6 rows and 7 columns in which the first column is labeled q and ranges from 0 to 5, and the other columns are labeled TC, FC, VC, MC, ATC, and AVC. Enter the information provided above into the appropriate cells of the table. Using this information, you should be able fill in all of the remaining cells of the table.)

116

likes
578 views

Answer to a math question Let q represent the amount of output produced by a particular firm. Let TC denote total costs of production for this firm, FC denote fixed costs, VC denote variable costs, MC denote marginal costs, ATC denote average total costs, and AVC denote average variable costs. Using this notation, the following is true about the firm’s cost structure: FC=$100 at q=0. MC=$60 at q=1. VC=$110 at q=2. ATC=$90 at q=3. AVC=$60 at q=4. TC=$420 at q=5. In dollars, what is TC at q=0? (Enter a number.) (Hint: Make a table with 6 rows and 7 columns in which the first column is labeled q and ranges from 0 to 5, and the other columns are labeled TC, FC, VC, MC, ATC, and AVC. Enter the information provided above into the appropriate cells of the table. Using this information, you should be able fill in all of the remaining cells of the table.)

Expert avatar
Jett
4.7
97 Answers
1. Start with the key understanding that Total Cost \((TC)\) is the sum of Fixed Cost \((FC)\) and Variable Cost \((VC)\), i.e., TC = FC + VC .

2. When \( q = 0 \), the variable cost \((VC)\) is typically zero because zero production implies no variable production expenses. Thus, VC at \( q = 0 \) is $0.

3. At \( q = 0 \), we are provided that the fixed cost \((FC)\) is $100.

4. Consequently, for \( q = 0 \):
TC = FC + VC = 100 + 0 = 100

Therefore, at \( q = 0 \), total cost \( TC \) is \( 100 \).

Frequently asked questions (FAQs)
What is the value of sinh(cosh(arcsinh(arccosh(2))))?
+
What is the derivative of the function f(x) = 3x^2 - 4x + 5 at x = 2?
+
What is the measure of an angle in a triangle if the other two angles are 45° and 75°?
+
New questions in Mathematics
calculate the derivative by the limit definition: f(x) = 6x^3 + 2
Solution of the equation y'' - y' -6y = 0
find the value of the tangent if it is known that the cos@= 1 2 and the sine is negative. must perform procedures.
-8+3/5
The random variable Y is defined as the sum between two different integers selected at random between -4 and 2 (both included). What are the possible values of the random variable Y? What is the value of P(Y=-3)? And whether it is less than or equal to -5?
A drawer contains three pairs of white socks, five pairs of black socks and two pairs of red socks. Caden randomly selects two pairs of socks on his way to the gym. What is the probability that both pairs of socks are black?
A juice shop prepares assorted juices, for their juices they have 5 different types of fruit. How many types of assortments can be prepared in total, if it is considered an assortment to a juice made with two or more fruits?
Find the root of x^4-10x^ 5=0 using Newton's method, with a precision of the smallest positive root.
The function g:Q→Q is a ring homomorphism such that g(3)=3 and g(5)=5. What are the values of g(8) and g(9)?
Find the equation of the line perpendicular to −5𝑥−3𝑦+5=0 passing through the point (0,−2)
Substitute a=2 and b=-3 and c=-4 to evaluate 2ac/(-2b^2-a)
form a key for your lock containing the numbers 2 2 5 8 How many different keys can you form?
Calculate the boiling temperature and freezing temperature at 1 atmosphere pressure of a solution formed by dissolving 123 grams of ferrous oxide in 1.890 grams of HCl.
How many square feet of floor area are there in three two-storey apartment houses, each of which is 38 feet wide and 76 feet long?
How to do 15 x 3304
At the dance there are 150 boys the rest are girls. If 65% are girls what is the total amount in the room
Determine a general formula​ (or formulas) for the solution to the following equation.​ Then, determine the specific solutions​ (if any) on the interval [0,2π). cos30=0
In poker, a full house consists of five cards, where two of the cards have the same number (or letter) and the remaining three also have the same number (or letter) as each other (but not as the previous two cards). Use a search engine or Wikipedia to understand the concept better if necessary. In how many different ways can one obtain a full house?
7-1=6 6x2=12 Explain that
A grain silo has a height of 8.8m with a 11.4m diameter. If it is filled 0.5% of it's volume, how much grain (m^3) is stored in the silo? (0 decimal places)